Home > Keywords >
| Catalog | name | Description | price |
|---|---|---|---|
| R-C-6677 | 4A-Carboxy-4B-methyl-cholest-8,24-dien-3B-ol CAS:32468-21-6 | 4A-Carboxy-4B-methyl-cholest-8,24-dien-3B-ol is a sterol related to Zymosterol(Z701520),which is an intermediate in the biosynthesis of cholesterol(C432501).Cholesterol is a major component of all biological membranes.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6678 | Bacilysin CAS:29393-20-2 | Bacilysin is produced by the strain of Bacillus subtilis A-14. It has gram-positive bacterial activity against Staphylococcus aureus and Dryness bacillus.Culture is enriched with bacillus subtilis(Bacilip in).Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6679 | Cenicriviroc Sulfone CAS:497223-22-0 | Cenicriviroc Sulfone is a derivative of Cenicriviroc(C256550)which is an experimental drug candidate for the treatment of HIV infection. It is an inhibitor of CCR2 and CCR5 receptors,allowing it to function as an entry inhibitor which prevents the virus from entering into a human cell.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6680 | C24:1 Ceramide-d7 CAS:1840942-16-6 | C24:1 Ceramide-d7 refers to a specific type of ceramide which is a class of lipid molecules that are important components of cell membranes and play key roles in various biological functions,including signaling, apoptosis,and skin barrier function.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6681 | (+)-Magnoflorine iodide CAS:4277-43-4 | (+)-Magnoflorine iodide is a compound that inhibits matrix metalloproteinase(MMP)activity.(+) - Magnoflorine iodide has antifungal activity, antioxidant and anti diabetes effects.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6682 | (3S)-beta-Cryptoxanthin CAS:1200446-88-3 | (3S)-beta-Cryptoxanthin is an analog of beta-carotene,which is a potent antioxidant with anticancer properties.It acts as a kinase inhibitor,blocking the activity of enzymes that promote tumor growth.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6683 | N-Cyclopropyl-5,6-dihydro-6-[4-[[[2-(2-oxa-7-azaspiro[3.5]non-7-yl)-3-pyridinyl]carbonyl]amino]benzo | N-Cyclopropyl-5,6-dihydro-6-[4-[[[2-(2-oxa-7-azaspiro[3.5]non-7-yl)-3-pyridinyl]carbonyl]amino]benzoyl]-4H-thieno[3,2-d][1]benzazepine-2-carboxamide is a possible respiratory syncytial virus (RSV) RNA polymerase inhibitor.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6684 | N6-[(2R,5S)-5-Amino-5-carboxy-2-hydroxypentyl]-5-oxo-L-lysine (Impurity) CAS:75658-82-1 | N6-[(2R,5S)-5-Amino-5-carboxy-2-hydroxypentyl]-5-oxo-L-lysine is a useful synthetic intermediate.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6685 | Carbacyclin CAS:69552-46-1 | Carbacyclin (Carbocyclic PGI2) is a stable prostacyclin analog found to inhibit platelet aggregation induced by collagen or ADP.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6686 | Carbocyclic Thromboxane A2 CAS:74034-56-3 | CTA2 is a stable analog of TXA2.It inhibits arachidonic acid-induced aggregation with an IC50 value of 4-5 uM.CTA2 also exhibits selective and dose-dependent inhibition of TXB2 synthesis in rabbit platelets at concentrations between 1 and 100 uM.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6687 | C16 Ceramide-d7 CAS:1840942-13-3 | C16 Ceramide-d7(d16:1,C16:0)is the deuterium labeled C16 Ceramide(d16:1,C16:0).Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6688 | C18 Ceramide-d7 CAS:1840942-14-4 | C18 Ceramide-d7 (d18:1-d7/18:0),C18-Ceramide-d7 is deuterium labeled C18-Ceramide.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6689 | C24 Ceramide-d7 CAS:1840942-15-5 | C24 Ceramide-d7(d18:1-d7/24:0),Ceramide-d7 is intended for use as an internal standard for the quantification of C24 ceramide by GC- or LC-MS.C24 Ceramide is one of the most abundant naturally occurring ceramides. | price> |
| R-C-6690 | CGM 097 Sulfate CAS:1313367-56-4 | CGM097 sulfate is a potent inhibitor of the human telomerase enzyme.CGM097 sulfate inhibits the growth of cancer cells by inhibiting the production of telomerase,an enzyme that promotes cell division.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6691 | N-(5-Chloropyridin-2-yl)-N-[(1S,2S,4R)-4-[(dimethylamino)carbonyl]-2-[[(5-methyl-4,5,6,7-tetrahydrot | N-(5-Chloropyridin-2-yl)-N-[(1S,2S,4R)-4-[(dimethylamino)carbonyl]-2-[[(5-methyl-4,5,6,7-tetrahydrothiazolo[5,4-c]pyridin-2-yl)carbonyl]amino]cyclohexyl]ethanediamide or Edoxaban Impurity H is an impurity of Edoxaban(E555520)which is an anticoagulant drug which acts as a direct factor Xa inhibitor.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6692 | CT 5269-10 CAS:209740-39-6 | CT 5269-10 is a Celltech Src kinase inhibitor.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6693 | 6-(2,6-Difluoro-3,5-dimethoxyphenyl)-N2,N2,N8,N8-tetramethylpyrido[3,4-d]pyrimidine-2,8-diamine CAS | 6-(2,6-Difluoro-3,5-dimethoxyphenyl)-N2,N2,N8,N8-tetramethylpyrido[3,4-d]pyrimidine-2,8-diamine is a selective FGFR1 inhibitor.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6694 | 4-Dehydroxy-4-dimethylhydroxysilyl Entecavir CAS:870614-82-7 | 4-Dehydroxy-4-dimethylhydroxysilyl Entecavir is an impurity of Entecavir (E558900).Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6695 | Descarboxymethyl Treprostinil CAS:101692-02-8 | Descarboxymethyl Treprostinil is an impurity in the synthesis of Treprostinil (T719500), Synthetic analog of Prostacyclin (P839060).Antihypertensive.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |
| R-C-6696 | Acetoxy-Lysylpyridinoline CAS:1321573-23-2 | Acetoxy-Lysylpyridinoline is used as a standard for HPLC.Our product is only used for scientific research and not for human clinical trials or consumption. | price> |

Items-$0.00

Email:
Tel.:
RuixiBiotechCo.Ltd /KamulinBiotechco.ltd
Add: Room 20F 2002, Meiyuan Building, Yanta District, Xi’ an City, Shaanxi Province 710061 China
Tel: 02988811435
Fax: (86-29)8881-1435
Email: sales@ruixibiotech.com
Web: http://www.ruixibiotech.com


